C16H18F2N2OS — CID 171181424
1-[(R)-(2,6-difluoro-4-methoxyphenyl)-thiophen-3-ylmethyl]piperazine (PubChem CID 171181424) has the molecular formula C16H18F2N2OS and a molecular weight of 324.40 g/mol. Its IUPAC name is 1-[(R)-(2,6-difluoro-4-methoxyphenyl)-thiophen-3-ylmethyl]piperazine.
| Compound Name | 1-[(R)-(2,6-difluoro-4-methoxyphenyl)-thiophen-3-ylmethyl]piperazine |
|---|---|
| PubChem CID | 171181424 |
| Molecular Formula | C16H18F2N2OS |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-[(R)-(2,6-difluoro-4-methoxyphenyl)-thiophen-3-ylmethyl]piperazine |
| SMILES | COc1cc(F)c([C@H](c2ccsc2)N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C16H18F2N2OS/c1-21-12-8-13(17)15(14(18)9-12)16(11-2-7-22-10-11)20-5-3-19-4-6-20/h2,7-10,16,19H,3-6H2,1H3/t16-/m0/s1 |
| InChIKey | FIXPACUBQVPLFP-INIZCTEOSA-N |
| XLogP | 3.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |