C18H24N2O3S — CID 5129561
1-[thiophen-3-yl-(2,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 5129561) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[thiophen-3-yl-(2,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[thiophen-3-yl-(2,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 5129561 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[thiophen-3-yl-(2,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(OC)c(C(c2ccsc2)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C18H24N2O3S/c1-21-15-11-17(23-3)16(22-2)10-14(15)18(13-4-9-24-12-13)20-7-5-19-6-8-20/h4,9-12,18-19H,5-8H2,1-3H3 |
| InChIKey | GDSWYFTTXLRYJK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |