C16H19ClF2N2OS — CID 171177510
1-[(S)-[2-(difluoromethoxy)phenyl]-thiophen-3-ylmethyl]piperazine;hydrochloride (PubChem CID 171177510) has the molecular formula C16H19ClF2N2OS and a molecular weight of 360.86 g/mol. Its IUPAC name is 1-[(S)-[2-(difluoromethoxy)phenyl]-thiophen-3-ylmethyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-[2-(difluoromethoxy)phenyl]-thiophen-3-ylmethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171177510 |
| Molecular Formula | C16H19ClF2N2OS |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1-[(S)-[2-(difluoromethoxy)phenyl]-thiophen-3-ylmethyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)Oc1ccccc1[C@@H](c1ccsc1)N1CCNCC1 |
| InChI | InChI=1S/C16H18F2N2OS.ClH/c17-16(18)21-14-4-2-1-3-13(14)15(12-5-10-22-11-12)20-8-6-19-7-9-20;/h1-5,10-11,15-16,19H,6-9H2;1H/t15-;/m1./s1 |
| InChIKey | RBAACNZYIVWHMV-XFULWGLBSA-N |
| XLogP | 3.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |