C16H17F3N2S2 — CID 171177575
1-[(R)-thiophen-3-yl-[2-(trifluoromethylsulfanyl)phenyl]methyl]piperazine (PubChem CID 171177575) has the molecular formula C16H17F3N2S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-[(R)-thiophen-3-yl-[2-(trifluoromethylsulfanyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-thiophen-3-yl-[2-(trifluoromethylsulfanyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171177575 |
| Molecular Formula | C16H17F3N2S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-[(R)-thiophen-3-yl-[2-(trifluoromethylsulfanyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)Sc1ccccc1[C@@H](c1ccsc1)N1CCNCC1 |
| InChI | InChI=1S/C16H17F3N2S2/c17-16(18,19)23-14-4-2-1-3-13(14)15(12-5-10-22-11-12)21-8-6-20-7-9-21/h1-5,10-11,15,20H,6-9H2/t15-/m1/s1 |
| InChIKey | KOQSLTJKTDSEJW-OAHLLOKOSA-N |
| XLogP | 4.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |