C17H19F3N2S — CID 3815578
1-[thiophen-3-yl-[2-(trifluoromethyl)phenyl]methyl]-1,4-diazepane (PubChem CID 3815578) has the molecular formula C17H19F3N2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-[thiophen-3-yl-[2-(trifluoromethyl)phenyl]methyl]-1,4-diazepane.
| Compound Name | 1-[thiophen-3-yl-[2-(trifluoromethyl)phenyl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3815578 |
| Molecular Formula | C17H19F3N2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[thiophen-3-yl-[2-(trifluoromethyl)phenyl]methyl]-1,4-diazepane |
| SMILES | FC(F)(F)c1ccccc1C(c1ccsc1)N1CCCNCC1 |
| InChI | InChI=1S/C17H19F3N2S/c18-17(19,20)15-5-2-1-4-14(15)16(13-6-11-23-12-13)22-9-3-7-21-8-10-22/h1-2,4-6,11-12,16,21H,3,7-10H2 |
| InChIKey | UGWYBRMLIHBNBD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |