C19H17ClF6N2 — CID 4258911
1-[[4-chloro-3-(trifluoromethyl)phenyl]-[2-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 4258911) has the molecular formula C19H17ClF6N2 and a molecular weight of 422.80 g/mol. Its IUPAC name is 1-[[4-chloro-3-(trifluoromethyl)phenyl]-[2-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]-[2-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 4258911 |
| Molecular Formula | C19H17ClF6N2 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-[[4-chloro-3-(trifluoromethyl)phenyl]-[2-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1cc(C(c2ccccc2C(F)(F)F)N2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C19H17ClF6N2/c20-16-6-5-12(11-15(16)19(24,25)26)17(28-9-7-27-8-10-28)13-3-1-2-4-14(13)18(21,22)23/h1-6,11,17,27H,7-10H2 |
| InChIKey | AWOMUCHZXFNDQT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |