C18H17BrClF3N2 — CID 3830015
1-[(3-bromophenyl)-[4-chloro-3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 3830015) has the molecular formula C18H17BrClF3N2 and a molecular weight of 433.70 g/mol. Its IUPAC name is 1-[(3-bromophenyl)-[4-chloro-3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(3-bromophenyl)-[4-chloro-3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 3830015 |
| Molecular Formula | C18H17BrClF3N2 |
| Molecular Weight | 433.70 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1-[(3-bromophenyl)-[4-chloro-3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1cc(C(c2cccc(Br)c2)N2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C18H17BrClF3N2/c19-14-3-1-2-12(10-14)17(25-8-6-24-7-9-25)13-4-5-16(20)15(11-13)18(21,22)23/h1-5,10-11,17,24H,6-9H2 |
| InChIKey | QWTIEJSJYIIOMQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |