C18H21BrN2 — CID 3457794
1-[(3-bromophenyl)-phenylmethyl]-1,4-diazepane (PubChem CID 3457794) has the molecular formula C18H21BrN2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 1-[(3-bromophenyl)-phenylmethyl]-1,4-diazepane.
| Compound Name | 1-[(3-bromophenyl)-phenylmethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3457794 |
| Molecular Formula | C18H21BrN2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-[(3-bromophenyl)-phenylmethyl]-1,4-diazepane |
| SMILES | Brc1cccc(C(c2ccccc2)N2CCCNCC2)c1 |
| InChI | InChI=1S/C18H21BrN2/c19-17-9-4-8-16(14-17)18(15-6-2-1-3-7-15)21-12-5-10-20-11-13-21/h1-4,6-9,14,18,20H,5,10-13H2 |
| InChIKey | CMDGUWYYEAAUKL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |