C18H22BrN3 — CID 5091302
1-[(3-bromophenyl)-(6-methyl-2-pyridinyl)methyl]-1,4-diazepane (PubChem CID 5091302) has the molecular formula C18H22BrN3 and a molecular weight of 360.30 g/mol. Its IUPAC name is 1-[(3-bromophenyl)-(6-methyl-2-pyridinyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(3-bromophenyl)-(6-methyl-2-pyridinyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 5091302 |
| Molecular Formula | C18H22BrN3 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-[(3-bromophenyl)-(6-methyl-2-pyridinyl)methyl]-1,4-diazepane |
| SMILES | Cc1cccc(C(c2cccc(Br)c2)N2CCCNCC2)n1 |
| InChI | InChI=1S/C18H22BrN3/c1-14-5-2-8-17(21-14)18(15-6-3-7-16(19)13-15)22-11-4-9-20-10-12-22/h2-3,5-8,13,18,20H,4,9-12H2,1H3 |
| InChIKey | ITQDWCQCVRRCJV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |