C18H18BrF3N2 — CID 3259924
1-[(3-bromophenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 3259924) has the molecular formula C18H18BrF3N2 and a molecular weight of 399.25 g/mol. Its IUPAC name is 1-[(3-bromophenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(3-bromophenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 3259924 |
| Molecular Formula | C18H18BrF3N2 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 1-[(3-bromophenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1cccc(C(c2cccc(Br)c2)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H18BrF3N2/c19-16-6-2-4-14(12-16)17(24-9-7-23-8-10-24)13-3-1-5-15(11-13)18(20,21)22/h1-6,11-12,17,23H,7-10H2 |
| InChIKey | ICBXARPOTFWINS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |