C19H19F3N2O2 — CID 4022492
1-[1,3-benzodioxol-5-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 4022492) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[1,3-benzodioxol-5-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 4022492 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1cccc(C(c2ccc3c(c2)OCO3)N2CCNCC2)c1 |
| InChI | InChI=1S/C19H19F3N2O2/c20-19(21,22)15-3-1-2-13(10-15)18(24-8-6-23-7-9-24)14-4-5-16-17(11-14)26-12-25-16/h1-5,10-11,18,23H,6-9,12H2 |
| InChIKey | FYSRKYQUUKRKHR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |