C17H19F3N2O — CID 3250165
1-[furan-2-yl-[3-(trifluoromethyl)phenyl]methyl]-1,4-diazepane (PubChem CID 3250165) has the molecular formula C17H19F3N2O and a molecular weight of 324.35 g/mol. Its IUPAC name is 1-[furan-2-yl-[3-(trifluoromethyl)phenyl]methyl]-1,4-diazepane.
| Compound Name | 1-[furan-2-yl-[3-(trifluoromethyl)phenyl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3250165 |
| Molecular Formula | C17H19F3N2O |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[furan-2-yl-[3-(trifluoromethyl)phenyl]methyl]-1,4-diazepane |
| SMILES | FC(F)(F)c1cccc(C(c2ccco2)N2CCCNCC2)c1 |
| InChI | InChI=1S/C17H19F3N2O/c18-17(19,20)14-5-1-4-13(12-14)16(15-6-2-11-23-15)22-9-3-7-21-8-10-22/h1-2,4-6,11-12,16,21H,3,7-10H2 |
| InChIKey | BJRIOZXXJTVMFV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |