C22H22F3N3 — CID 3695417
4-[1,4-diazepan-1-yl-[3-(trifluoromethyl)phenyl]methyl]quinoline (PubChem CID 3695417) has the molecular formula C22H22F3N3 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-[1,4-diazepan-1-yl-[3-(trifluoromethyl)phenyl]methyl]quinoline.
| Compound Name | 4-[1,4-diazepan-1-yl-[3-(trifluoromethyl)phenyl]methyl]quinoline |
|---|---|
| PubChem CID | 3695417 |
| Molecular Formula | C22H22F3N3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-[1,4-diazepan-1-yl-[3-(trifluoromethyl)phenyl]methyl]quinoline |
| SMILES | FC(F)(F)c1cccc(C(c2ccnc3ccccc23)N2CCCNCC2)c1 |
| InChI | InChI=1S/C22H22F3N3/c23-22(24,25)17-6-3-5-16(15-17)21(28-13-4-10-26-12-14-28)19-9-11-27-20-8-2-1-7-18(19)20/h1-3,5-9,11,15,21,26H,4,10,12-14H2 |
| InChIKey | QATCYUNMPSTGPH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |