C18H18F4N2 — CID 4646092
1-[(4-fluorophenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 4646092) has the molecular formula C18H18F4N2 and a molecular weight of 338.35 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(4-fluorophenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 4646092 |
| Molecular Formula | C18H18F4N2 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[(4-fluorophenyl)-[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | Fc1ccc(C(c2cccc(C(F)(F)F)c2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C18H18F4N2/c19-16-6-4-13(5-7-16)17(24-10-8-23-9-11-24)14-2-1-3-15(12-14)18(20,21)22/h1-7,12,17,23H,8-11H2 |
| InChIKey | RJTUGHFHLMGXTD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |