C18H21F3N2S — CID 4271045
1-[(5-ethylthiophen-2-yl)-[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 4271045) has the molecular formula C18H21F3N2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 1-[(5-ethylthiophen-2-yl)-[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(5-ethylthiophen-2-yl)-[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 4271045 |
| Molecular Formula | C18H21F3N2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-[(5-ethylthiophen-2-yl)-[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | CCc1ccc(C(c2cccc(C(F)(F)F)c2)N2CCNCC2)s1 |
| InChI | InChI=1S/C18H21F3N2S/c1-2-15-6-7-16(24-15)17(23-10-8-22-9-11-23)13-4-3-5-14(12-13)18(19,20)21/h3-7,12,17,22H,2,8-11H2,1H3 |
| InChIKey | ITNQBXHDFJJECB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |