C16H17Cl2F3N2O — CID 171177928
1-[(S)-[3-chloro-4-(trifluoromethyl)phenyl]-(furan-2-yl)methyl]piperazine;hydrochloride (PubChem CID 171177928) has the molecular formula C16H17Cl2F3N2O and a molecular weight of 381.23 g/mol. Its IUPAC name is 1-[(S)-[3-chloro-4-(trifluoromethyl)phenyl]-(furan-2-yl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-[3-chloro-4-(trifluoromethyl)phenyl]-(furan-2-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171177928 |
| Molecular Formula | C16H17Cl2F3N2O |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-[(S)-[3-chloro-4-(trifluoromethyl)phenyl]-(furan-2-yl)methyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc([C@@H](c2ccco2)N2CCNCC2)cc1Cl |
| InChI | InChI=1S/C16H16ClF3N2O.ClH/c17-13-10-11(3-4-12(13)16(18,19)20)15(14-2-1-9-23-14)22-7-5-21-6-8-22;/h1-4,9-10,15,21H,5-8H2;1H/t15-;/m0./s1 |
| InChIKey | MWBGNYYQEZLQEK-RSAXXLAASA-N |
| XLogP | 4.37 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |