C16H18ClF3N2O — CID 171176421
1-[(S)-furan-2-yl-[2-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171176421) has the molecular formula C16H18ClF3N2O and a molecular weight of 346.78 g/mol. Its IUPAC name is 1-[(S)-furan-2-yl-[2-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-furan-2-yl-[2-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171176421 |
| Molecular Formula | C16H18ClF3N2O |
| Molecular Weight | 346.78 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[(S)-furan-2-yl-[2-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccccc1[C@@H](c1ccco1)N1CCNCC1 |
| InChI | InChI=1S/C16H17F3N2O.ClH/c17-16(18,19)13-5-2-1-4-12(13)15(14-6-3-11-22-14)21-9-7-20-8-10-21;/h1-6,11,15,20H,7-10H2;1H/t15-;/m0./s1 |
| InChIKey | OBESCBJTFKCPPX-RSAXXLAASA-N |
| XLogP | 3.71 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |