C16H17F3N2O2 — CID 171180697
1-[(R)-furan-2-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171180697) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 1-[(R)-furan-2-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-furan-2-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171180697 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[(R)-furan-2-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)Oc1ccccc1[C@H](c1ccco1)N1CCNCC1 |
| InChI | InChI=1S/C16H17F3N2O2/c17-16(18,19)23-13-5-2-1-4-12(13)15(14-6-3-11-22-14)21-9-7-20-8-10-21/h1-6,11,15,20H,7-10H2/t15-/m1/s1 |
| InChIKey | JRBBPIRIXIECRP-OAHLLOKOSA-N |
| XLogP | 3.17 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |