C16H19Cl2F3N2OS — CID 171280475
1-[(R)-thiophen-2-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171280475) has the molecular formula C16H19Cl2F3N2OS and a molecular weight of 415.31 g/mol. Its IUPAC name is 1-[(R)-thiophen-2-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-thiophen-2-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171280475 |
| Molecular Formula | C16H19Cl2F3N2OS |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 1-[(R)-thiophen-2-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)Oc1ccccc1[C@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C16H17F3N2OS.2ClH/c17-16(18,19)22-13-5-2-1-4-12(13)15(14-6-3-11-23-14)21-9-7-20-8-10-21;;/h1-6,11,15,20H,7-10H2;2*1H/t15-;;/m1../s1 |
| InChIKey | UDZULRDAWYABDD-QCUBGVIVSA-N |
| XLogP | 4.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |