C15H20Cl2N2OS — CID 171287287
2-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride (PubChem CID 171287287) has the molecular formula C15H20Cl2N2OS and a molecular weight of 347.31 g/mol. Its IUPAC name is 2-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride.
| Compound Name | 2-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171287287 |
| Molecular Formula | C15H20Cl2N2OS |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-[(S)-piperazin-1-yl(thiophen-2-yl)methyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1ccccc1[C@@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C15H18N2OS.2ClH/c18-13-5-2-1-4-12(13)15(14-6-3-11-19-14)17-9-7-16-8-10-17;;/h1-6,11,15-16,18H,7-10H2;2*1H/t15-;;/m0../s1 |
| InChIKey | WEPZLMCEDLLGKM-CKUXDGONSA-N |
| XLogP | 3.29 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|