C16H19Cl2N3OS — CID 171299617
2-hydroxy-3-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzonitrile;dihydrochloride (PubChem CID 171299617) has the molecular formula C16H19Cl2N3OS and a molecular weight of 372.32 g/mol. Its IUPAC name is 2-hydroxy-3-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzonitrile;dihydrochloride.
| Compound Name | 2-hydroxy-3-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171299617 |
| Molecular Formula | C16H19Cl2N3OS |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-hydroxy-3-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#Cc1cccc([C@H](c2cccs2)N2CCNCC2)c1O |
| InChI | InChI=1S/C16H17N3OS.2ClH/c17-11-12-3-1-4-13(16(12)20)15(14-5-2-10-21-14)19-8-6-18-7-9-19;;/h1-5,10,15,18,20H,6-9H2;2*1H/t15-;;/m1../s1 |
| InChIKey | GPZRFONAONSSRE-QCUBGVIVSA-N |
| XLogP | 3.16 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|