C16H16N4O3S — CID 171299536
4-hydroxy-3-nitro-5-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzonitrile (PubChem CID 171299536) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 4-hydroxy-3-nitro-5-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzonitrile.
| Compound Name | 4-hydroxy-3-nitro-5-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 171299536 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-hydroxy-3-nitro-5-[(R)-piperazin-1-yl(thiophen-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1cc([C@H](c2cccs2)N2CCNCC2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N4O3S/c17-10-11-8-12(16(21)13(9-11)20(22)23)15(14-2-1-7-24-14)19-5-3-18-4-6-19/h1-2,7-9,15,18,21H,3-6H2/t15-/m1/s1 |
| InChIKey | DDADHPMMBHBUIR-OAHLLOKOSA-N |
| XLogP | 2.23 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|