C16H22Cl2N4O3 — CID 171299551
4-hydroxy-3-nitro-5-[(1S)-1-piperazin-1-ylpent-4-enyl]benzonitrile;dihydrochloride (PubChem CID 171299551) has the molecular formula C16H22Cl2N4O3 and a molecular weight of 389.28 g/mol. Its IUPAC name is 4-hydroxy-3-nitro-5-[(1S)-1-piperazin-1-ylpent-4-enyl]benzonitrile;dihydrochloride.
| Compound Name | 4-hydroxy-3-nitro-5-[(1S)-1-piperazin-1-ylpent-4-enyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171299551 |
| Molecular Formula | C16H22Cl2N4O3 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 4-hydroxy-3-nitro-5-[(1S)-1-piperazin-1-ylpent-4-enyl]benzonitrile;dihydrochloride |
| SMILES | C=CCC[C@@H](c1cc(C#N)cc([N+](=O)[O-])c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H20N4O3.2ClH/c1-2-3-4-14(19-7-5-18-6-8-19)13-9-12(11-17)10-15(16(13)21)20(22)23;;/h2,9-10,14,18,21H,1,3-8H2;2*1H/t14-;;/m0../s1 |
| InChIKey | DBTFJCNKECBSGM-UTLKBRERSA-N |
| XLogP | 2.93 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|