C16H23Cl2N3O — CID 171299631
2-hydroxy-3-[(1S)-1-piperazin-1-ylpent-4-enyl]benzonitrile;dihydrochloride (PubChem CID 171299631) has the molecular formula C16H23Cl2N3O and a molecular weight of 344.29 g/mol. Its IUPAC name is 2-hydroxy-3-[(1S)-1-piperazin-1-ylpent-4-enyl]benzonitrile;dihydrochloride.
| Compound Name | 2-hydroxy-3-[(1S)-1-piperazin-1-ylpent-4-enyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171299631 |
| Molecular Formula | C16H23Cl2N3O |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-hydroxy-3-[(1S)-1-piperazin-1-ylpent-4-enyl]benzonitrile;dihydrochloride |
| SMILES | C=CCC[C@@H](c1cccc(C#N)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H21N3O.2ClH/c1-2-3-7-15(19-10-8-18-9-11-19)14-6-4-5-13(12-17)16(14)20;;/h2,4-6,15,18,20H,1,3,7-11H2;2*1H/t15-;;/m0../s1 |
| InChIKey | MQKZAGDPWVZRSN-CKUXDGONSA-N |
| XLogP | 3.02 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|