C12H13N3O3 — CID 171255839
3-[(1S)-1-aminopent-4-enyl]-4-hydroxy-5-nitrobenzonitrile (PubChem CID 171255839) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-[(1S)-1-aminopent-4-enyl]-4-hydroxy-5-nitrobenzonitrile.
| Compound Name | 3-[(1S)-1-aminopent-4-enyl]-4-hydroxy-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 171255839 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-[(1S)-1-aminopent-4-enyl]-4-hydroxy-5-nitrobenzonitrile |
| SMILES | C=CCC[C@H](N)c1cc(C#N)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C12H13N3O3/c1-2-3-4-10(14)9-5-8(7-13)6-11(12(9)16)15(17)18/h2,5-6,10,16H,1,3-4,14H2/t10-/m0/s1 |
| InChIKey | BRJCKUKHWCPUFG-JTQLQIEISA-N |
| XLogP | 2.14 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|