C12H13FN2O — CID 171254437
3-[(1S)-1-aminopent-4-enyl]-5-fluoro-4-hydroxybenzonitrile (PubChem CID 171254437) has the molecular formula C12H13FN2O and a molecular weight of 220.25 g/mol. Its IUPAC name is 3-[(1S)-1-aminopent-4-enyl]-5-fluoro-4-hydroxybenzonitrile.
| Compound Name | 3-[(1S)-1-aminopent-4-enyl]-5-fluoro-4-hydroxybenzonitrile |
|---|---|
| PubChem CID | 171254437 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-[(1S)-1-aminopent-4-enyl]-5-fluoro-4-hydroxybenzonitrile |
| SMILES | C=CCC[C@H](N)c1cc(C#N)cc(F)c1O |
| InChI | InChI=1S/C12H13FN2O/c1-2-3-4-11(15)9-5-8(7-14)6-10(13)12(9)16/h2,5-6,11,16H,1,3-4,15H2/t11-/m0/s1 |
| InChIKey | SDRLHXUVUZHTLH-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|