C11H14ClFN2O — CID 171254427
3-[(1S)-1-aminobutyl]-5-fluoro-4-hydroxybenzonitrile;hydrochloride (PubChem CID 171254427) has the molecular formula C11H14ClFN2O and a molecular weight of 244.70 g/mol. Its IUPAC name is 3-[(1S)-1-aminobutyl]-5-fluoro-4-hydroxybenzonitrile;hydrochloride.
| Compound Name | 3-[(1S)-1-aminobutyl]-5-fluoro-4-hydroxybenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171254427 |
| Molecular Formula | C11H14ClFN2O |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-[(1S)-1-aminobutyl]-5-fluoro-4-hydroxybenzonitrile;hydrochloride |
| SMILES | CCC[C@H](N)c1cc(C#N)cc(F)c1O.Cl |
| InChI | InChI=1S/C11H13FN2O.ClH/c1-2-3-10(14)8-4-7(6-13)5-9(12)11(8)15;/h4-5,10,15H,2-3,14H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | OIQZWDHVQISDOY-PPHPATTJSA-N |
| XLogP | 2.62 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|