C9H9BrClFN2O — CID 171254455
3-[(1R)-1-amino-2-fluoroethyl]-5-bromo-4-hydroxybenzonitrile;hydrochloride (PubChem CID 171254455) has the molecular formula C9H9BrClFN2O and a molecular weight of 295.54 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2-fluoroethyl]-5-bromo-4-hydroxybenzonitrile;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-2-fluoroethyl]-5-bromo-4-hydroxybenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171254455 |
| Molecular Formula | C9H9BrClFN2O |
| Molecular Weight | 295.54 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 3-[(1R)-1-amino-2-fluoroethyl]-5-bromo-4-hydroxybenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cc(Br)c(O)c([C@@H](N)CF)c1 |
| InChI | InChI=1S/C9H8BrFN2O.ClH/c10-7-2-5(4-12)1-6(9(7)14)8(13)3-11;/h1-2,8,14H,3,13H2;1H/t8-;/m0./s1 |
| InChIKey | OVNCOHFLIKTSOD-QRPNPIFTSA-N |
| XLogP | 2.42 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|