C11H11BrN2O3 — CID 171257790
methyl (3R)-3-amino-3-(3-bromo-5-cyano-2-hydroxyphenyl)propanoate (PubChem CID 171257790) has the molecular formula C11H11BrN2O3 and a molecular weight of 299.12 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3-bromo-5-cyano-2-hydroxyphenyl)propanoate.
| Compound Name | methyl (3R)-3-amino-3-(3-bromo-5-cyano-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 171257790 |
| Molecular Formula | C11H11BrN2O3 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | methyl (3R)-3-amino-3-(3-bromo-5-cyano-2-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C[C@@H](N)c1cc(C#N)cc(Br)c1O |
| InChI | InChI=1S/C11H11BrN2O3/c1-17-10(15)4-9(14)7-2-6(5-13)3-8(12)11(7)16/h2-3,9,16H,4,14H2,1H3/t9-/m1/s1 |
| InChIKey | WKBVRPTYVUHKTB-SECBINFHSA-N |
| XLogP | 1.59 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|