C10H11BrN2O5 — CID 171244531
methyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate (PubChem CID 171244531) has the molecular formula C10H11BrN2O5 and a molecular weight of 319.11 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate.
| Compound Name | methyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 171244531 |
| Molecular Formula | C10H11BrN2O5 |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | methyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate |
| SMILES | COC(=O)C[C@H](N)c1cc(Br)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C10H11BrN2O5/c1-18-9(14)4-7(12)6-2-5(11)3-8(10(6)15)13(16)17/h2-3,7,15H,4,12H2,1H3/t7-/m0/s1 |
| InChIKey | ROCWXOPDWYMADR-ZETCQYMHSA-N |
| XLogP | 1.63 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|