C12H15BrClN3O6 — CID 18518152
methyl 3-[(2-aminoacetyl)amino]-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride (PubChem CID 18518152) has the molecular formula C12H15BrClN3O6 and a molecular weight of 412.62 g/mol. Its IUPAC name is methyl 3-[(2-aminoacetyl)amino]-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride.
| Compound Name | methyl 3-[(2-aminoacetyl)amino]-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 18518152 |
| Molecular Formula | C12H15BrClN3O6 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | methyl 3-[(2-aminoacetyl)amino]-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride |
| SMILES | COC(=O)CC(NC(=O)CN)c1cc(Br)cc([N+](=O)[O-])c1O.Cl |
| InChI | InChI=1S/C12H14BrN3O6.ClH/c1-22-11(18)4-8(15-10(17)5-14)7-2-6(13)3-9(12(7)19)16(20)21;/h2-3,8,19H,4-5,14H2,1H3,(H,15,17);1H |
| InChIKey | RGOKMLMUUWVSPC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|