C13H16BrClN2O4 — CID 59984237
ethyl (3S)-3-[(2-aminoacetyl)amino]-3-(5-bromo-3-chloro-2-hydroxyphenyl)propanoate (PubChem CID 59984237) has the molecular formula C13H16BrClN2O4 and a molecular weight of 379.64 g/mol. Its IUPAC name is ethyl (3S)-3-[(2-aminoacetyl)amino]-3-(5-bromo-3-chloro-2-hydroxyphenyl)propanoate.
| Compound Name | ethyl (3S)-3-[(2-aminoacetyl)amino]-3-(5-bromo-3-chloro-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 59984237 |
| Molecular Formula | C13H16BrClN2O4 |
| Molecular Weight | 379.64 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | ethyl (3S)-3-[(2-aminoacetyl)amino]-3-(5-bromo-3-chloro-2-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)CN)c1cc(Br)cc(Cl)c1O |
| InChI | InChI=1S/C13H16BrClN2O4/c1-2-21-12(19)5-10(17-11(18)6-16)8-3-7(14)4-9(15)13(8)20/h3-4,10,20H,2,5-6,16H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | TXIBZTIAAVDQAR-JTQLQIEISA-N |
| XLogP | 1.88 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.64 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|