C18H24ClIN2O6 — CID 20619340
ethyl 3-(5-chloro-2-hydroxy-3-iodophenyl)-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoate (PubChem CID 20619340) has the molecular formula C18H24ClIN2O6 and a molecular weight of 526.76 g/mol. Its IUPAC name is ethyl 3-(5-chloro-2-hydroxy-3-iodophenyl)-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-(5-chloro-2-hydroxy-3-iodophenyl)-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 20619340 |
| Molecular Formula | C18H24ClIN2O6 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | ethyl 3-(5-chloro-2-hydroxy-3-iodophenyl)-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CNC(=O)OC(C)(C)C)c1cc(Cl)cc(I)c1O |
| InChI | InChI=1S/C18H24ClIN2O6/c1-5-27-15(24)8-13(11-6-10(19)7-12(20)16(11)25)22-14(23)9-21-17(26)28-18(2,3)4/h6-7,13,25H,5,8-9H2,1-4H3,(H,21,26)(H,22,23) |
| InChIKey | CFHPNJXPHDXKHB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|