C19H19Cl2N5O5S — CID 20619320
ethyl 3-[[2-[[4-(azidomethyl)thiophene-3-carbonyl]amino]acetyl]amino]-3-(3,5-dichloro-2-hydroxyphenyl)propanoate (PubChem CID 20619320) has the molecular formula C19H19Cl2N5O5S and a molecular weight of 500.36 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-(azidomethyl)thiophene-3-carbonyl]amino]acetyl]amino]-3-(3,5-dichloro-2-hydroxyphenyl)propanoate.
| Compound Name | ethyl 3-[[2-[[4-(azidomethyl)thiophene-3-carbonyl]amino]acetyl]amino]-3-(3,5-dichloro-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 20619320 |
| Molecular Formula | C19H19Cl2N5O5S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | ethyl 3-[[2-[[4-(azidomethyl)thiophene-3-carbonyl]amino]acetyl]amino]-3-(3,5-dichloro-2-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CNC(=O)c1cscc1CN=[N+]=[N-])c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C19H19Cl2N5O5S/c1-2-31-17(28)5-15(12-3-11(20)4-14(21)18(12)29)25-16(27)7-23-19(30)13-9-32-8-10(13)6-24-26-22/h3-4,8-9,15,29H,2,5-7H2,1H3,(H,23,30)(H,25,27) |
| InChIKey | IOPZALFTYDLAIR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 153.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|