C19H17Cl3N4O7 — CID 20619325
ethyl 3-[[2-[(6-chloro-5-nitropyridine-3-carbonyl)amino]acetyl]amino]-3-(3,5-dichloro-2-hydroxyphenyl)propanoate (PubChem CID 20619325) has the molecular formula C19H17Cl3N4O7 and a molecular weight of 519.73 g/mol. Its IUPAC name is ethyl 3-[[2-[(6-chloro-5-nitropyridine-3-carbonyl)amino]acetyl]amino]-3-(3,5-dichloro-2-hydroxyphenyl)propanoate.
| Compound Name | ethyl 3-[[2-[(6-chloro-5-nitropyridine-3-carbonyl)amino]acetyl]amino]-3-(3,5-dichloro-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 20619325 |
| Molecular Formula | C19H17Cl3N4O7 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | ethyl 3-[[2-[(6-chloro-5-nitropyridine-3-carbonyl)amino]acetyl]amino]-3-(3,5-dichloro-2-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CNC(=O)c1cnc(Cl)c([N+](=O)[O-])c1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C19H17Cl3N4O7/c1-2-33-16(28)6-13(11-4-10(20)5-12(21)17(11)29)25-15(27)8-24-19(30)9-3-14(26(31)32)18(22)23-7-9/h3-5,7,13,29H,2,6,8H2,1H3,(H,24,30)(H,25,27) |
| InChIKey | JVVRUVISRAXMHY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 160.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|