C14H20N2O4 — CID 54698700
ethyl 3-[(2-aminoacetyl)amino]-3-(2-hydroxy-5-methylphenyl)propanoate (PubChem CID 54698700) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is ethyl 3-[(2-aminoacetyl)amino]-3-(2-hydroxy-5-methylphenyl)propanoate.
| Compound Name | ethyl 3-[(2-aminoacetyl)amino]-3-(2-hydroxy-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 54698700 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | ethyl 3-[(2-aminoacetyl)amino]-3-(2-hydroxy-5-methylphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CN)c1cc(C)ccc1O |
| InChI | InChI=1S/C14H20N2O4/c1-3-20-14(19)7-11(16-13(18)8-15)10-6-9(2)4-5-12(10)17/h4-6,11,17H,3,7-8,15H2,1-2H3,(H,16,18) |
| InChIKey | ILZAEDUHBGJOMY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|