C22H22N2O4 — CID 18518046
methyl 3-[(2-aminoacetyl)amino]-3-(2-hydroxy-4-naphthalen-1-ylphenyl)propanoate (PubChem CID 18518046) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl 3-[(2-aminoacetyl)amino]-3-(2-hydroxy-4-naphthalen-1-ylphenyl)propanoate.
| Compound Name | methyl 3-[(2-aminoacetyl)amino]-3-(2-hydroxy-4-naphthalen-1-ylphenyl)propanoate |
|---|---|
| PubChem CID | 18518046 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl 3-[(2-aminoacetyl)amino]-3-(2-hydroxy-4-naphthalen-1-ylphenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)CN)c1ccc(-c2cccc3ccccc23)cc1O |
| InChI | InChI=1S/C22H22N2O4/c1-28-22(27)12-19(24-21(26)13-23)18-10-9-15(11-20(18)25)17-8-4-6-14-5-2-3-7-16(14)17/h2-11,19,25H,12-13,23H2,1H3,(H,24,26) |
| InChIKey | QCKXUJQGKGZAEV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|