C8H14N2O5 — CID 54389865
dimethyl (2S)-2-[(2-aminoacetyl)amino]butanedioate (PubChem CID 54389865) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is dimethyl (2S)-2-[(2-aminoacetyl)amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[(2-aminoacetyl)amino]butanedioate |
|---|---|
| PubChem CID | 54389865 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | dimethyl (2S)-2-[(2-aminoacetyl)amino]butanedioate |
| SMILES | COC(=O)C[C@H](NC(=O)CN)C(=O)OC |
| InChI | InChI=1S/C8H14N2O5/c1-14-7(12)3-5(8(13)15-2)10-6(11)4-9/h5H,3-4,9H2,1-2H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | VFWDKDRADQCDDM-YFKPBYRVSA-N |
| XLogP | -1.83 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |