C15H25ClN2O5 — CID 119768790
dimethyl 2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]butanedioate;hydrochloride (PubChem CID 119768790) has the molecular formula C15H25ClN2O5 and a molecular weight of 348.83 g/mol. Its IUPAC name is dimethyl 2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]butanedioate;hydrochloride.
| Compound Name | dimethyl 2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]butanedioate;hydrochloride |
|---|---|
| PubChem CID | 119768790 |
| Molecular Formula | C15H25ClN2O5 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | dimethyl 2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]butanedioate;hydrochloride |
| SMILES | COC(=O)CC(NC(=O)CC1CC2CCC(C1)N2)C(=O)OC.Cl |
| InChI | InChI=1S/C15H24N2O5.ClH/c1-21-14(19)8-12(15(20)22-2)17-13(18)7-9-5-10-3-4-11(6-9)16-10;/h9-12,16H,3-8H2,1-2H3,(H,17,18);1H |
| InChIKey | KGKKKSCXLJEYBQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |