C14H24N2O3S — CID 79607868
(2S)-2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 79607868) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is (2S)-2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 79607868 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2S)-2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)CC1CC2CCC(C1)N2)C(=O)O |
| InChI | InChI=1S/C14H24N2O3S/c1-20-5-4-12(14(18)19)16-13(17)8-9-6-10-2-3-11(7-9)15-10/h9-12,15H,2-8H2,1H3,(H,16,17)(H,18,19)/t9?,10?,11?,12-/m0/s1 |
| InChIKey | ULZLXRWCMCZJSC-ROAFRPBMSA-N |
| XLogP | 1.23 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |