C12H20N2O4 — CID 80750585
(2R)-2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 80750585) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2R)-2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80750585 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (2R)-2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | O=C(CC1CC2CCC(C1)N2)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C12H20N2O4/c15-6-10(12(17)18)14-11(16)5-7-3-8-1-2-9(4-7)13-8/h7-10,13,15H,1-6H2,(H,14,16)(H,17,18)/t7?,8?,9?,10-/m1/s1 |
| InChIKey | BTFWFHBVHUYXEM-SYZWKDNESA-N |
| XLogP | -0.53 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |