C15H26N2O4 — CID 81084212
2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-5-methoxypentanoic acid (PubChem CID 81084212) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-5-methoxypentanoic acid.
| Compound Name | 2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81084212 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)CC1CC2CCC(C1)N2)C(=O)O |
| InChI | InChI=1S/C15H26N2O4/c1-21-6-2-3-13(15(19)20)17-14(18)9-10-7-11-4-5-12(8-10)16-11/h10-13,16H,2-9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | NDSJLAPKJODVQN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|