C12H21NO6S — CID 81076824
2-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]-5-methoxypentanoic acid (PubChem CID 81076824) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]-5-methoxypentanoic acid.
| Compound Name | 2-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81076824 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)CC1CCS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C12H21NO6S/c1-19-5-2-3-10(12(15)16)13-11(14)7-9-4-6-20(17,18)8-9/h9-10H,2-8H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | BLSVWRFDQDRSLY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|