C9H17NO3S — CID 171049196
2-(1,1-dioxothiolan-3-yl)-N-propan-2-ylacetamide (PubChem CID 171049196) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 171049196 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO3S/c1-7(2)10-9(11)5-8-3-4-14(12,13)6-8/h7-8H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | YXJJDJCXKVFDHW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |