C11H19NO3S — CID 3538538
N-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 3538538) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is N-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 3538538 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | N-cyclopentyl-2-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NC1CCCC1 |
| InChI | InChI=1S/C11H19NO3S/c13-11(12-10-3-1-2-4-10)7-9-5-6-16(14,15)8-9/h9-10H,1-8H2,(H,12,13) |
| InChIKey | QGLSGXWZQQFLJG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |