C13H23NO3S — CID 7222590
N-cycloheptyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 7222590) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-cycloheptyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-cycloheptyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 7222590 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N-cycloheptyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NC1CCCCCC1 |
| InChI | InChI=1S/C13H23NO3S/c15-13(9-11-7-8-18(16,17)10-11)14-12-5-3-1-2-4-6-12/h11-12H,1-10H2,(H,14,15)/t11-/m0/s1 |
| InChIKey | FVVYXNRWKXAXCD-NSHDSACASA-N |
| XLogP | 1.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |