C15H28N2O3S — CID 81486869
N-[2-(cycloheptylamino)ethyl]-2-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 81486869) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 81486869 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C15H28N2O3S/c18-15(11-13-7-10-21(19,20)12-13)17-9-8-16-14-5-3-1-2-4-6-14/h13-14,16H,1-12H2,(H,17,18) |
| InChIKey | XBGBLLCYOSZTQG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|