C11H21NO4S — CID 107299589
2-(1,1-dioxothiolan-3-yl)-N-(4-hydroxypentyl)acetamide (PubChem CID 107299589) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-(4-hydroxypentyl)acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-(4-hydroxypentyl)acetamide |
|---|---|
| PubChem CID | 107299589 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-(4-hydroxypentyl)acetamide |
| SMILES | CC(O)CCCNC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21NO4S/c1-9(13)3-2-5-12-11(14)7-10-4-6-17(15,16)8-10/h9-10,13H,2-8H2,1H3,(H,12,14) |
| InChIKey | NNWHPKUQGGGXGC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|