C16H23NO3S — CID 95281062
2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(3S)-3-phenylbutyl]acetamide (PubChem CID 95281062) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(3S)-3-phenylbutyl]acetamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(3S)-3-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 95281062 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(3S)-3-phenylbutyl]acetamide |
| SMILES | C[C@@H](CCNC(=O)C[C@@H]1CCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3S/c1-13(15-5-3-2-4-6-15)7-9-17-16(18)11-14-8-10-21(19,20)12-14/h2-6,13-14H,7-12H2,1H3,(H,17,18)/t13-,14-/m0/s1 |
| InChIKey | KOULQEOZYBZQPC-KBPBESRZSA-N |
| XLogP | 2.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |