C15H23NO2S — CID 63922445
1,1-dioxo-N-(3-phenylbutyl)thian-3-amine (PubChem CID 63922445) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 1,1-dioxo-N-(3-phenylbutyl)thian-3-amine.
| Compound Name | 1,1-dioxo-N-(3-phenylbutyl)thian-3-amine |
|---|---|
| PubChem CID | 63922445 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1,1-dioxo-N-(3-phenylbutyl)thian-3-amine |
| SMILES | CC(CCNC1CCCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C15H23NO2S/c1-13(14-6-3-2-4-7-14)9-10-16-15-8-5-11-19(17,18)12-15/h2-4,6-7,13,15-16H,5,8-12H2,1H3 |
| InChIKey | CBFPRUAKWUZNSF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |